
| product Name | Ethyl acetate |
|---|---|
| Synonyms | Acetic acid ethyl ester; ethyl acetate B&J brand 4 L; ETHYLACETATE ULTRA RESI-ANAL.; ETHYL ACETATE CAPILLARY GRADE; Ethyl Acetate Specially Purified - SPECIFIED; Acetic Ether; RFE; acetic ester |
| Molecular Formula | C4H8O2 |
| Molecular Weight | 88.1051 |
| InChI | InChI=1/C4H8O2/c1-3-6-4(2)5/h3H2,1-2H3 |
| CAS Registry Number | 141-78-6 |
| EINECS | 205-500-4 |
| Molecular Structure | ![]() |
| Density | 0.898g/cm3 |
| Melting point | -83.5℃ |
| Boiling point | 73.9°C at 760 mmHg |
| Refractive index | 1.373 |
| Water solubility | 80 g/L (20℃) |
| Vapour Pressur | 112mmHg at 25°C |