3-Methyl-4-nitrobenzoic acid
| product Name |
3-Methyl-4-nitrobenzoic acid |
| Synonyms |
4-Nitro-m-toluic acid; 3-Methy-4-nitrobenzoatic Acid; 4-Nitro-3-Methyl benzoic acid; m-Methyl-p-Nitrobenzoic acid; 3-methyl-4-nitrobenzoate; RARECHEM AL BO 0346 |
| Molecular Formula |
C8H6NO4 |
| Molecular Weight |
180.1381 |
| InChI |
InChI=1/C8H7NO4/c1-5-4-6(8(10)11)2-3-7(5)9(12)13/h2-4H,1H3,(H,10,11)/p-1 |
| CAS Registry Number |
3113-71-1 |
| EINECS |
221-479-4 |
| Molecular Structure |
 |
| Melting point |
216-218℃ |
| Boiling point |
356°C at 760 mmHg |
| Flash point |
161.2°C |
| Water solubility |
<0.1 g/100 mL at 22℃ |
| Vapour Pressur |
1.1E-05mmHg at 25°C |